C24H16Cl5F3N4O2 — CID 134418389
2,2-dichloro-N-[4-chloro-3-[[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 134418389) has the molecular formula C24H16Cl5F3N4O2 and a molecular weight of 626.68 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134418389 |
| Molecular Formula | C24H16Cl5F3N4O2 |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 623.97 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CN(NC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl)c1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C24H16Cl5F3N4O2/c1-36(18-8-12(4-5-33-18)24(30,31)32)35-21(37)16-10-15(2-3-17(16)27)34-22(38)20-19(23(20,28)29)11-6-13(25)9-14(26)7-11/h2-10,19-20H,1H3,(H,34,38)(H,35,37) |
| InChIKey | VBQHCDUADFJTEA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|