C22H14Cl6N4O2 — CID 140860174
trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[(3-chloro-2-pyridinyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 140860174) has the molecular formula C22H14Cl6N4O2 and a molecular weight of 579.10 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[(3-chloro-2-pyridinyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[(3-chloro-2-pyridinyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140860174 |
| Molecular Formula | C22H14Cl6N4O2 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 575.92 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[(3-chloro-2-pyridinyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NNc1ncccc1Cl)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C22H14Cl6N4O2/c23-11-6-10(7-12(24)8-11)17-18(22(17,27)28)21(34)30-13-3-4-15(25)14(9-13)20(33)32-31-19-16(26)2-1-5-29-19/h1-9,17-18H,(H,29,31)(H,30,34)(H,32,33)/t17-,18+/m0/s1 |
| InChIKey | MSGBHSUHXOLVHB-ZWKOTPCHSA-N |
| XLogP | 6.98 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|