C21H12Cl5FN4O2 — CID 122619229
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(5-fluoropyrimidin-2-yl)benzamide (PubChem CID 122619229) has the molecular formula C21H12Cl5FN4O2 and a molecular weight of 548.62 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(5-fluoropyrimidin-2-yl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(5-fluoropyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 122619229 |
| Molecular Formula | C21H12Cl5FN4O2 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 545.94 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(5-fluoropyrimidin-2-yl)benzamide |
| SMILES | O=C(Nc1ncc(F)cn1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H12Cl5FN4O2/c22-10-3-9(4-11(23)5-10)16-17(21(16,25)26)19(33)30-13-1-2-15(24)14(6-13)18(32)31-20-28-7-12(27)8-29-20/h1-8,16-17H,(H,30,33)(H,28,29,31,32) |
| InChIKey | KTSIVGFXHDOMDT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|