C22H11Cl5F2IN3O2 — CID 122617301
2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,5-difluoro-4-iodo-2-pyridinyl)benzamide (PubChem CID 122617301) has the molecular formula C22H11Cl5F2IN3O2 and a molecular weight of 691.51 g/mol. Its IUPAC name is 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,5-difluoro-4-iodo-2-pyridinyl)benzamide.
| Compound Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,5-difluoro-4-iodo-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 122617301 |
| Molecular Formula | C22H11Cl5F2IN3O2 |
| Molecular Weight | 691.51 g/mol |
| Exact Mass | 688.83 |
| IUPAC Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(3,5-difluoro-4-iodo-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1ncc(F)c(I)c1F)c1cc(NC(=O)[C@@H]2[C@@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C22H11Cl5F2IN3O2/c23-9-3-8(4-10(24)5-9)15-16(22(15,26)27)21(35)32-11-1-2-13(25)12(6-11)20(34)33-19-17(29)18(30)14(28)7-31-19/h1-7,15-16H,(H,32,35)(H,31,33,34)/t15-,16+/m1/s1 |
| InChIKey | MCXLEMDIWPNLIY-CVEARBPZSA-N |
| XLogP | 7.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.51 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|