C23H12BrCl5F2N2O2 — CID 134417984
N-(3-bromo-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 134417984) has the molecular formula C23H12BrCl5F2N2O2 and a molecular weight of 643.53 g/mol. Its IUPAC name is N-(3-bromo-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(3-bromo-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 134417984 |
| Molecular Formula | C23H12BrCl5F2N2O2 |
| Molecular Weight | 643.53 g/mol |
| Exact Mass | 639.85 |
| IUPAC Name | N-(3-bromo-2,4-difluorophenyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(F)c(Br)c1F)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H12BrCl5F2N2O2/c24-19-15(30)3-4-16(20(19)31)33-21(34)13-8-12(1-2-14(13)27)32-22(35)18-17(23(18,28)29)9-5-10(25)7-11(26)6-9/h1-8,17-18H,(H,32,35)(H,33,34) |
| InChIKey | CZHDGHNXDQKXFB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.53 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|