C24H14Cl5FN2O3 — CID 122630121
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-formylphenyl)benzamide (PubChem CID 122630121) has the molecular formula C24H14Cl5FN2O3 and a molecular weight of 574.65 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-formylphenyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-formylphenyl)benzamide |
|---|---|
| PubChem CID | 122630121 |
| Molecular Formula | C24H14Cl5FN2O3 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 571.94 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-formylphenyl)benzamide |
| SMILES | O=Cc1ccc(NC(=O)c2cc(NC(=O)C3C(c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C24H14Cl5FN2O3/c25-13-6-12(7-14(26)8-13)20-21(24(20,28)29)23(35)31-15-2-3-17(27)16(9-15)22(34)32-19-4-1-11(10-33)5-18(19)30/h1-10,20-21H,(H,31,35)(H,32,34) |
| InChIKey | GXUHYGBRXMBCCK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|