C23H13Cl5FN3O4 — CID 122617928
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-nitrophenyl)benzamide (PubChem CID 122617928) has the molecular formula C23H13Cl5FN3O4 and a molecular weight of 591.64 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-nitrophenyl)benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 122617928 |
| Molecular Formula | C23H13Cl5FN3O4 |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 588.93 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-fluoro-4-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1F)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H13Cl5FN3O4/c24-11-5-10(6-12(25)7-11)19-20(23(19,27)28)22(34)30-13-1-3-16(26)15(8-13)21(33)31-18-4-2-14(32(35)36)9-17(18)29/h1-9,19-20H,(H,30,34)(H,31,33)/t19-,20+/m0/s1 |
| InChIKey | GXEFVTXQVOEKBF-VQTJNVASSA-N |
| XLogP | 7.47 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|