C24H16Cl5N3O4 — CID 122618161
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methyl-4-nitrophenyl)benzamide (PubChem CID 122618161) has the molecular formula C24H16Cl5N3O4 and a molecular weight of 587.67 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methyl-4-nitrophenyl)benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methyl-4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 122618161 |
| Molecular Formula | C24H16Cl5N3O4 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 584.96 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methyl-4-nitrophenyl)benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H16Cl5N3O4/c1-11-6-16(32(35)36)3-5-19(11)31-22(33)17-10-15(2-4-18(17)27)30-23(34)21-20(24(21,28)29)12-7-13(25)9-14(26)8-12/h2-10,20-21H,1H3,(H,30,34)(H,31,33)/t20-,21+/m0/s1 |
| InChIKey | VYBAUZCBUJBSTJ-LEWJYISDSA-N |
| XLogP | 7.64 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|