C27H24Cl5N3O3 — CID 134418201
2-chloro-5-[[(3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2-methoxyethylamino)-2-methylphenyl]benzamide (PubChem CID 134418201) has the molecular formula C27H24Cl5N3O3 and a molecular weight of 615.77 g/mol. Its IUPAC name is 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2-methoxyethylamino)-2-methylphenyl]benzamide.
| Compound Name | 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2-methoxyethylamino)-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 134418201 |
| Molecular Formula | C27H24Cl5N3O3 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2-methoxyethylamino)-2-methylphenyl]benzamide |
| SMILES | COCCNc1ccc(NC(=O)c2cc(NC(=O)C3[C@H](c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C27H24Cl5N3O3/c1-14-9-18(33-7-8-38-2)4-6-22(14)35-25(36)20-13-19(3-5-21(20)30)34-26(37)24-23(27(24,31)32)15-10-16(28)12-17(29)11-15/h3-6,9-13,23-24,33H,7-8H2,1-2H3,(H,34,37)(H,35,36)/t23-,24?/m0/s1 |
| InChIKey | PCQZEHSKTUNCCI-UXMRNZNESA-N |
| XLogP | 7.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|