C23H23Cl5N2O4 — CID 122622248
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 122622248) has the molecular formula C23H23Cl5N2O4 and a molecular weight of 568.71 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 122622248 |
| Molecular Formula | C23H23Cl5N2O4 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H23Cl5N2O4/c1-33-7-8-34-6-2-5-29-21(31)17-12-16(3-4-18(17)26)30-22(32)20-19(23(20,27)28)13-9-14(24)11-15(25)10-13/h3-4,9-12,19-20H,2,5-8H2,1H3,(H,29,31)(H,30,32)/t19-,20+/m0/s1 |
| InChIKey | MAWQQLUAIDJZON-VQTJNVASSA-N |
| XLogP | 5.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|