C21H19Cl5N2O2 — CID 122621475
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylpropyl)benzamide (PubChem CID 122621475) has the molecular formula C21H19Cl5N2O2 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 122621475 |
| Molecular Formula | C21H19Cl5N2O2 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H19Cl5N2O2/c1-10(2)9-27-19(29)15-8-14(3-4-16(15)24)28-20(30)18-17(21(18,25)26)11-5-12(22)7-13(23)6-11/h3-8,10,17-18H,9H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | OSFYQIHAXKTQQV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|