C20H17Cl5N2O3S — CID 122622141
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylsulfinylethyl)benzamide (PubChem CID 122622141) has the molecular formula C20H17Cl5N2O3S and a molecular weight of 542.70 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylsulfinylethyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylsulfinylethyl)benzamide |
|---|---|
| PubChem CID | 122622141 |
| Molecular Formula | C20H17Cl5N2O3S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 539.94 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(2-methylsulfinylethyl)benzamide |
| SMILES | CS(=O)CCNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C20H17Cl5N2O3S/c1-31(30)5-4-26-18(28)14-9-13(2-3-15(14)23)27-19(29)17-16(20(17,24)25)10-6-11(21)8-12(22)7-10/h2-3,6-9,16-17H,4-5H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | UHHOIYCQBJJJNO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|