C24H24Cl5N3O3 — CID 134418636
N-(5-acetamidopentyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 134418636) has the molecular formula C24H24Cl5N3O3 and a molecular weight of 579.74 g/mol. Its IUPAC name is N-(5-acetamidopentyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(5-acetamidopentyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 134418636 |
| Molecular Formula | C24H24Cl5N3O3 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 577.03 |
| IUPAC Name | N-(5-acetamidopentyl)-2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | CC(=O)NCCCCCNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H24Cl5N3O3/c1-13(33)30-7-3-2-4-8-31-22(34)18-12-17(5-6-19(18)27)32-23(35)21-20(24(21,28)29)14-9-15(25)11-16(26)10-14/h5-6,9-12,20-21H,2-4,7-8H2,1H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | AWKDRQGRHKHXLS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|