C24H23Cl5N2O3 — CID 157325214
N-[3-(6-acetamidohexanoyl)-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 157325214) has the molecular formula C24H23Cl5N2O3 and a molecular weight of 564.72 g/mol. Its IUPAC name is N-[3-(6-acetamidohexanoyl)-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[3-(6-acetamidohexanoyl)-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 157325214 |
| Molecular Formula | C24H23Cl5N2O3 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | N-[3-(6-acetamidohexanoyl)-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CC(=O)NCCCCCC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H23Cl5N2O3/c1-13(32)30-8-4-2-3-5-20(33)18-12-17(6-7-19(18)27)31-23(34)22-21(24(22,28)29)14-9-15(25)11-16(26)10-14/h6-7,9-12,21-22H,2-5,8H2,1H3,(H,30,32)(H,31,34) |
| InChIKey | BEQDLOXCLZUBKQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|