C21H18Cl5NO4S — CID 157067730
2,2-dichloro-N-[4-chloro-3-(4-methylsulfonylbutanoyl)phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 157067730) has the molecular formula C21H18Cl5NO4S and a molecular weight of 557.71 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-(4-methylsulfonylbutanoyl)phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-(4-methylsulfonylbutanoyl)phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 157067730 |
| Molecular Formula | C21H18Cl5NO4S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 554.94 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-(4-methylsulfonylbutanoyl)phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CS(=O)(=O)CCCC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H18Cl5NO4S/c1-32(30,31)6-2-3-17(28)15-10-14(4-5-16(15)24)27-20(29)19-18(21(19,25)26)11-7-12(22)9-13(23)8-11/h4-5,7-10,18-19H,2-3,6H2,1H3,(H,27,29) |
| InChIKey | WJAMAUHEHSACMP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|