C23H23Cl5N2O2 — CID 122621563
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-hexylbenzamide (PubChem CID 122621563) has the molecular formula C23H23Cl5N2O2 and a molecular weight of 536.71 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-hexylbenzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-hexylbenzamide |
|---|---|
| PubChem CID | 122621563 |
| Molecular Formula | C23H23Cl5N2O2 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-hexylbenzamide |
| SMILES | CCCCCCNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H23Cl5N2O2/c1-2-3-4-5-8-29-21(31)17-12-16(6-7-18(17)26)30-22(32)20-19(23(20,27)28)13-9-14(24)11-15(25)10-13/h6-7,9-12,19-20H,2-5,8H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | MWLXNTUGUHQCJD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|