C20H16Cl5N3O3 — CID 140860175
trans-(1R,3R)-N-[3-[[acetyl(methyl)amino]carbamoyl]-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 140860175) has the molecular formula C20H16Cl5N3O3 and a molecular weight of 523.63 g/mol. Its IUPAC name is trans-(1R,3R)-N-[3-[[acetyl(methyl)amino]carbamoyl]-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-N-[3-[[acetyl(methyl)amino]carbamoyl]-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140860175 |
| Molecular Formula | C20H16Cl5N3O3 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | trans-(1R,3R)-N-[3-[[acetyl(methyl)amino]carbamoyl]-4-chlorophenyl]-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CC(=O)N(C)NC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C20H16Cl5N3O3/c1-9(29)28(2)27-18(30)14-8-13(3-4-15(14)23)26-19(31)17-16(20(17,24)25)10-5-11(21)7-12(22)6-10/h3-8,16-17H,1-2H3,(H,26,31)(H,27,30)/t16-,17+/m0/s1 |
| InChIKey | AWXJWLIDZLHNCS-DLBZAZTESA-N |
| XLogP | 5.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|