C21H15Cl5F3N3O3 — CID 140859627
trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[methyl(3,3,3-trifluoropropanoyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 140859627) has the molecular formula C21H15Cl5F3N3O3 and a molecular weight of 591.63 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[methyl(3,3,3-trifluoropropanoyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[methyl(3,3,3-trifluoropropanoyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140859627 |
| Molecular Formula | C21H15Cl5F3N3O3 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 588.95 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[[methyl(3,3,3-trifluoropropanoyl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CN(NC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C21H15Cl5F3N3O3/c1-32(15(33)8-20(27,28)29)31-18(34)13-7-12(2-3-14(13)24)30-19(35)17-16(21(17,25)26)9-4-10(22)6-11(23)5-9/h2-7,16-17H,8H2,1H3,(H,30,35)(H,31,34)/t16-,17+/m0/s1 |
| InChIKey | MRUYSNVESNQLKX-DLBZAZTESA-N |
| XLogP | 6.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|