C23H20Cl5F3N2O3S — CID 122621520
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(2R)-1-(3,3,3-trifluoropropylsulfinyl)propan-2-yl]benzamide (PubChem CID 122621520) has the molecular formula C23H20Cl5F3N2O3S and a molecular weight of 638.75 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(2R)-1-(3,3,3-trifluoropropylsulfinyl)propan-2-yl]benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(2R)-1-(3,3,3-trifluoropropylsulfinyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 122621520 |
| Molecular Formula | C23H20Cl5F3N2O3S |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 635.96 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(2R)-1-(3,3,3-trifluoropropylsulfinyl)propan-2-yl]benzamide |
| SMILES | C[C@H](CS(=O)CCC(F)(F)F)NC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H20Cl5F3N2O3S/c1-11(10-37(36)5-4-22(29,30)31)32-20(34)16-9-15(2-3-17(16)26)33-21(35)19-18(23(19,27)28)12-6-13(24)8-14(25)7-12/h2-3,6-9,11,18-19H,4-5,10H2,1H3,(H,32,34)(H,33,35)/t11-,18?,19?,37?/m1/s1 |
| InChIKey | BQNLGNIOOJQUDX-YIRVAPRVSA-N |
| XLogP | 6.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|