C25H16Cl5F3N2O4S — CID 122618605
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide (PubChem CID 122618605) has the molecular formula C25H16Cl5F3N2O4S and a molecular weight of 674.74 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 122618605 |
| Molecular Formula | C25H16Cl5F3N2O4S |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 671.92 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)CC(F)(F)F)cc1)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C25H16Cl5F3N2O4S/c26-13-7-12(8-14(27)9-13)20-21(25(20,29)30)23(37)35-16-3-6-19(28)18(10-16)22(36)34-15-1-4-17(5-2-15)40(38,39)11-24(31,32)33/h1-10,20-21H,11H2,(H,34,36)(H,35,37)/t20-,21+/m0/s1 |
| InChIKey | WIYSCZUWQCSNNE-LEWJYISDSA-N |
| XLogP | 7.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|