C21H19Cl5N4O3 — CID 140860155
trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(propan-2-ylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 140860155) has the molecular formula C21H19Cl5N4O3 and a molecular weight of 552.67 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(propan-2-ylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(propan-2-ylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140860155 |
| Molecular Formula | C21H19Cl5N4O3 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-[4-chloro-3-[(propan-2-ylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)NC(=O)NNC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H19Cl5N4O3/c1-9(2)27-20(33)30-29-18(31)14-8-13(3-4-15(14)24)28-19(32)17-16(21(17,25)26)10-5-11(22)7-12(23)6-10/h3-9,16-17H,1-2H3,(H,28,32)(H,29,31)(H2,27,30,33)/t16-,17+/m0/s1 |
| InChIKey | BYLJBUMCUVUBRY-DLBZAZTESA-N |
| XLogP | 5.53 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|