C21H13Cl6N5O2 — CID 134418866
2,2-dichloro-N-[4-chloro-3-[[(6-chloropyridazin-3-yl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 134418866) has the molecular formula C21H13Cl6N5O2 and a molecular weight of 580.09 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[[(6-chloropyridazin-3-yl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[[(6-chloropyridazin-3-yl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134418866 |
| Molecular Formula | C21H13Cl6N5O2 |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 576.92 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[[(6-chloropyridazin-3-yl)amino]carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NNc1ccc(Cl)nn1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H13Cl6N5O2/c22-10-5-9(6-11(23)7-10)17-18(21(17,26)27)20(34)28-12-1-2-14(24)13(8-12)19(33)32-31-16-4-3-15(25)29-30-16/h1-8,17-18H,(H,28,34)(H,30,31)(H,32,33) |
| InChIKey | VMEQHJFXGPZDOU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|