C22H15Cl5N4O2 — CID 134418395
2,2-dichloro-N-[4-chloro-3-[(pyridin-2-ylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 134418395) has the molecular formula C22H15Cl5N4O2 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[(pyridin-2-ylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[(pyridin-2-ylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134418395 |
| Molecular Formula | C22H15Cl5N4O2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 541.96 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[(pyridin-2-ylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NNc1ccccn1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C22H15Cl5N4O2/c23-12-7-11(8-13(24)9-12)18-19(22(18,26)27)21(33)29-14-4-5-16(25)15(10-14)20(32)31-30-17-3-1-2-6-28-17/h1-10,18-19H,(H,28,30)(H,29,33)(H,31,32) |
| InChIKey | DUHMKPZFJUHHGC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|