C23H15Cl5N2O3 — CID 122621267
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-phenoxybenzamide (PubChem CID 122621267) has the molecular formula C23H15Cl5N2O3 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-phenoxybenzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-phenoxybenzamide |
|---|---|
| PubChem CID | 122621267 |
| Molecular Formula | C23H15Cl5N2O3 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 541.95 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-phenoxybenzamide |
| SMILES | O=C(NOc1ccccc1)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H15Cl5N2O3/c24-13-8-12(9-14(25)10-13)19-20(23(19,27)28)22(32)29-15-6-7-18(26)17(11-15)21(31)30-33-16-4-2-1-3-5-16/h1-11,19-20H,(H,29,32)(H,30,31)/t19-,20+/m0/s1 |
| InChIKey | VTSTXCBFJFDWOW-VQTJNVASSA-N |
| XLogP | 6.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|