C24H14Cl5N3O2 — CID 122617577
2-chloro-N-(2-cyanophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122617577) has the molecular formula C24H14Cl5N3O2 and a molecular weight of 553.66 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-cyanophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122617577 |
| Molecular Formula | C24H14Cl5N3O2 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 550.95 |
| IUPAC Name | 2-chloro-N-(2-cyanophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | N#Cc1ccccc1NC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H14Cl5N3O2/c25-14-7-13(8-15(26)9-14)20-21(24(20,28)29)23(34)31-16-5-6-18(27)17(10-16)22(33)32-19-4-2-1-3-12(19)11-30/h1-10,20-21H,(H,31,34)(H,32,33)/t20-,21+/m0/s1 |
| InChIKey | ZJDYSTCOUNQSTF-LEWJYISDSA-N |
| XLogP | 7.30 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|