C25H16Cl5N3O2 — CID 122618916
2-chloro-N-(2-cyano-5-methylphenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122618916) has the molecular formula C25H16Cl5N3O2 and a molecular weight of 567.69 g/mol. Its IUPAC name is 2-chloro-N-(2-cyano-5-methylphenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-cyano-5-methylphenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122618916 |
| Molecular Formula | C25H16Cl5N3O2 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 564.97 |
| IUPAC Name | 2-chloro-N-(2-cyano-5-methylphenyl)-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Cc1ccc(C#N)c(NC(=O)c2cc(NC(=O)C3C(c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C25H16Cl5N3O2/c1-12-2-3-13(11-31)20(6-12)33-23(34)18-10-17(4-5-19(18)28)32-24(35)22-21(25(22,29)30)14-7-15(26)9-16(27)8-14/h2-10,21-22H,1H3,(H,32,35)(H,33,34) |
| InChIKey | OAEWIBGHQFYZIO-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|