C24H17Cl5N4O3 — CID 134418882
2,2-dichloro-N-[4-chloro-3-[(phenylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 134418882) has the molecular formula C24H17Cl5N4O3 and a molecular weight of 586.69 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-chloro-3-[(phenylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-chloro-3-[(phenylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134418882 |
| Molecular Formula | C24H17Cl5N4O3 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 583.97 |
| IUPAC Name | 2,2-dichloro-N-[4-chloro-3-[(phenylcarbamoylamino)carbamoyl]phenyl]-3-(3,5-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C24H17Cl5N4O3/c25-13-8-12(9-14(26)10-13)19-20(24(19,28)29)22(35)30-16-6-7-18(27)17(11-16)21(34)32-33-23(36)31-15-4-2-1-3-5-15/h1-11,19-20H,(H,30,35)(H,32,34)(H2,31,33,36) |
| InChIKey | PCBROPPOYFKTHL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|