C23H15Cl5N4O2 — CID 138546105
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-pyridin-2-ylmethylideneamino]benzamide (PubChem CID 138546105) has the molecular formula C23H15Cl5N4O2 and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-pyridin-2-ylmethylideneamino]benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-pyridin-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 138546105 |
| Molecular Formula | C23H15Cl5N4O2 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-pyridin-2-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccccn1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H15Cl5N4O2/c24-13-7-12(8-14(25)9-13)19-20(23(19,27)28)22(34)31-15-4-5-18(26)17(10-15)21(33)32-30-11-16-3-1-2-6-29-16/h1-11,19-20H,(H,31,34)(H,32,33)/b30-11+ |
| InChIKey | PEDHMKBGAVNKGR-KNBZMSCYSA-N |
| XLogP | 6.33 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|