C21H13Cl5N4O2S — CID 138546041
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-1,3-thiazol-2-ylmethylideneamino]benzamide (PubChem CID 138546041) has the molecular formula C21H13Cl5N4O2S and a molecular weight of 562.69 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-1,3-thiazol-2-ylmethylideneamino]benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-1,3-thiazol-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 138546041 |
| Molecular Formula | C21H13Cl5N4O2S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(E)-1,3-thiazol-2-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1nccs1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H13Cl5N4O2S/c22-11-5-10(6-12(23)7-11)17-18(21(17,25)26)20(32)29-13-1-2-15(24)14(8-13)19(31)30-28-9-16-27-3-4-33-16/h1-9,17-18H,(H,29,32)(H,30,31)/b28-9+ |
| InChIKey | XBNVMKUVQAVVSR-HIUVJMHLSA-N |
| XLogP | 6.39 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|