C26H16Cl5N3O2 — CID 122619097
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-quinolin-7-ylbenzamide (PubChem CID 122619097) has the molecular formula C26H16Cl5N3O2 and a molecular weight of 579.70 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-quinolin-7-ylbenzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-quinolin-7-ylbenzamide |
|---|---|
| PubChem CID | 122619097 |
| Molecular Formula | C26H16Cl5N3O2 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 576.97 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-quinolin-7-ylbenzamide |
| SMILES | O=C(Nc1ccc2cccnc2c1)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C26H16Cl5N3O2/c27-15-8-14(9-16(28)10-15)22-23(26(22,30)31)25(36)34-17-5-6-20(29)19(11-17)24(35)33-18-4-3-13-2-1-7-32-21(13)12-18/h1-12,22-23H,(H,33,35)(H,34,36) |
| InChIKey | HOVJNBBEDSVAJY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|