C23H15Cl6N3O2 — CID 122622269
2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 122622269) has the molecular formula C23H15Cl6N3O2 and a molecular weight of 578.11 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 122622269 |
| Molecular Formula | C23H15Cl6N3O2 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 574.93 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1cc(NC(=O)C2C(c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C23H15Cl6N3O2/c24-15-5-4-12(9-14(15)21(33)31-10-13-3-1-2-6-30-13)32-22(34)19-18(23(19,28)29)11-7-16(25)20(27)17(26)8-11/h1-9,18-19H,10H2,(H,31,33)(H,32,34) |
| InChIKey | DDHJDVDPMJPHNE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|