C20H12Cl6F2N2O2 — CID 122632814
2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,2-difluorocyclopropyl)benzamide (PubChem CID 122632814) has the molecular formula C20H12Cl6F2N2O2 and a molecular weight of 563.04 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,2-difluorocyclopropyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,2-difluorocyclopropyl)benzamide |
|---|---|
| PubChem CID | 122632814 |
| Molecular Formula | C20H12Cl6F2N2O2 |
| Molecular Weight | 563.04 g/mol |
| Exact Mass | 559.90 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(2,2-difluorocyclopropyl)benzamide |
| SMILES | O=C(NC1CC1(F)F)c1cc(NC(=O)C2C(c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C20H12Cl6F2N2O2/c21-10-2-1-8(5-9(10)17(31)30-13-6-19(13,27)28)29-18(32)15-14(20(15,25)26)7-3-11(22)16(24)12(23)4-7/h1-5,13-15H,6H2,(H,29,32)(H,30,31) |
| InChIKey | LTQJKYZITFPHLR-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.04 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|