C23H23Cl3N2O4S — CID 163446379
2-chloro-5-[[2,2-dichloro-3-(3,4,5-trimethylphenyl)cyclopropanecarbonyl]amino]-N-(1,1-dioxothietan-3-yl)benzamide (PubChem CID 163446379) has the molecular formula C23H23Cl3N2O4S and a molecular weight of 529.87 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trimethylphenyl)cyclopropanecarbonyl]amino]-N-(1,1-dioxothietan-3-yl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trimethylphenyl)cyclopropanecarbonyl]amino]-N-(1,1-dioxothietan-3-yl)benzamide |
|---|---|
| PubChem CID | 163446379 |
| Molecular Formula | C23H23Cl3N2O4S |
| Molecular Weight | 529.87 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,4,5-trimethylphenyl)cyclopropanecarbonyl]amino]-N-(1,1-dioxothietan-3-yl)benzamide |
| SMILES | Cc1cc(C2C(C(=O)Nc3ccc(Cl)c(C(=O)NC4CS(=O)(=O)C4)c3)C2(Cl)Cl)cc(C)c1C |
| InChI | InChI=1S/C23H23Cl3N2O4S/c1-11-6-14(7-12(2)13(11)3)19-20(23(19,25)26)22(30)27-15-4-5-18(24)17(8-15)21(29)28-16-9-33(31,32)10-16/h4-8,16,19-20H,9-10H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | BCWQQSDQPKWSKK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|