C21H16Cl6N2O2S — CID 122615387
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(thiolan-3-yl)benzamide (PubChem CID 122615387) has the molecular formula C21H16Cl6N2O2S and a molecular weight of 573.16 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(thiolan-3-yl)benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 122615387 |
| Molecular Formula | C21H16Cl6N2O2S |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 569.91 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-(thiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCSC1)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C21H16Cl6N2O2S/c22-13-2-1-10(7-12(13)19(30)29-11-3-4-32-8-11)28-20(31)17-16(21(17,26)27)9-5-14(23)18(25)15(24)6-9/h1-2,5-7,11,16-17H,3-4,8H2,(H,28,31)(H,29,30)/t11?,16-,17+/m0/s1 |
| InChIKey | IZEZOMUKFJIJRG-DZLJAHQNSA-N |
| XLogP | 7.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|