C24H17Cl6N3O2 — CID 122617892
N-(4-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 122617892) has the molecular formula C24H17Cl6N3O2 and a molecular weight of 592.14 g/mol. Its IUPAC name is N-(4-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(4-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122617892 |
| Molecular Formula | C24H17Cl6N3O2 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 588.95 |
| IUPAC Name | N-(4-amino-2-methylphenyl)-2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | Cc1cc(N)ccc1NC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C24H17Cl6N3O2/c1-10-6-12(31)2-5-18(10)33-22(34)14-9-13(3-4-15(14)25)32-23(35)20-19(24(20,29)30)11-7-16(26)21(28)17(27)8-11/h2-9,19-20H,31H2,1H3,(H,32,35)(H,33,34)/t19-,20+/m0/s1 |
| InChIKey | VKURKIANXYUUQM-VQTJNVASSA-N |
| XLogP | 7.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|