C18H16Cl3N3O2 — CID 138652651
N-(4-amino-2-methylphenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide (PubChem CID 138652651) has the molecular formula C18H16Cl3N3O2 and a molecular weight of 412.70 g/mol. Its IUPAC name is N-(4-amino-2-methylphenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide.
| Compound Name | N-(4-amino-2-methylphenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 138652651 |
| Molecular Formula | C18H16Cl3N3O2 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(4-amino-2-methylphenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
| SMILES | Cc1cc(N)ccc1NC(=O)c1cc(NC(=O)C2CC2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl3N3O2/c1-9-6-10(22)2-5-15(9)24-16(25)12-7-11(3-4-14(12)19)23-17(26)13-8-18(13,20)21/h2-7,13H,8,22H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | XGZIDVYYCUIMNH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|