C20H15Cl4F2N3O3 — CID 166988628
2-chloro-N-[3-(2-chloropropanoylamino)-2,4-difluorophenyl]-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide (PubChem CID 166988628) has the molecular formula C20H15Cl4F2N3O3 and a molecular weight of 525.17 g/mol. Its IUPAC name is 2-chloro-N-[3-(2-chloropropanoylamino)-2,4-difluorophenyl]-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide.
| Compound Name | 2-chloro-N-[3-(2-chloropropanoylamino)-2,4-difluorophenyl]-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 166988628 |
| Molecular Formula | C20H15Cl4F2N3O3 |
| Molecular Weight | 525.17 g/mol |
| Exact Mass | 522.98 |
| IUPAC Name | 2-chloro-N-[3-(2-chloropropanoylamino)-2,4-difluorophenyl]-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
| SMILES | CC(Cl)C(=O)Nc1c(F)ccc(NC(=O)c2cc(NC(=O)C3CC3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C20H15Cl4F2N3O3/c1-8(21)17(30)29-16-13(25)4-5-14(15(16)26)28-18(31)10-6-9(2-3-12(10)22)27-19(32)11-7-20(11,23)24/h2-6,8,11H,7H2,1H3,(H,27,32)(H,28,31)(H,29,30) |
| InChIKey | VDGSEPJSLJPMAO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.17 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|