C27H16Cl6F5N3O3S — CID 155757492
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[2-(trifluoromethylsulfanyl)propanoylamino]phenyl]benzamide (PubChem CID 155757492) has the molecular formula C27H16Cl6F5N3O3S and a molecular weight of 770.22 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[2-(trifluoromethylsulfanyl)propanoylamino]phenyl]benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[2-(trifluoromethylsulfanyl)propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 155757492 |
| Molecular Formula | C27H16Cl6F5N3O3S |
| Molecular Weight | 770.22 g/mol |
| Exact Mass | 766.90 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[2-(trifluoromethylsulfanyl)propanoylamino]phenyl]benzamide |
| SMILES | CC(SC(F)(F)F)C(=O)Nc1c(F)ccc(NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4cc(Cl)c(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C27H16Cl6F5N3O3S/c1-9(45-27(36,37)38)23(42)41-22-16(34)4-5-17(21(22)35)40-24(43)12-8-11(2-3-13(12)28)39-25(44)19-18(26(19,32)33)10-6-14(29)20(31)15(30)7-10/h2-9,18-19H,1H3,(H,39,44)(H,40,43)(H,41,42)/t9?,18-,19+/m0/s1 |
| InChIKey | UWNOCJGSKDGCHZ-RHQPJKKBSA-N |
| XLogP | 9.94 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.22 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|