C29H24Cl5F2N3O4 — CID 163584455
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-[3-(2-ethoxypropanoylamino)-2,4-difluorophenyl]benzamide (PubChem CID 163584455) has the molecular formula C29H24Cl5F2N3O4 and a molecular weight of 693.79 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-[3-(2-ethoxypropanoylamino)-2,4-difluorophenyl]benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-[3-(2-ethoxypropanoylamino)-2,4-difluorophenyl]benzamide |
|---|---|
| PubChem CID | 163584455 |
| Molecular Formula | C29H24Cl5F2N3O4 |
| Molecular Weight | 693.79 g/mol |
| Exact Mass | 691.02 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4-dichloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-[3-(2-ethoxypropanoylamino)-2,4-difluorophenyl]benzamide |
| SMILES | CCOC(C)C(=O)Nc1c(F)ccc(NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4cc(C)c(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C29H24Cl5F2N3O4/c1-4-43-13(3)26(40)39-25-19(35)7-8-20(24(25)36)38-27(41)16-11-15(5-6-17(16)30)37-28(42)22-21(29(22,33)34)14-9-12(2)23(32)18(31)10-14/h5-11,13,21-22H,4H2,1-3H3,(H,37,42)(H,38,41)(H,39,40)/t13?,21-,22+/m0/s1 |
| InChIKey | GKHYPLVQSYUECG-DFDINQLCSA-N |
| XLogP | 8.38 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.79 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|