C26H14Cl6F5N3O4S — CID 139571427
2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[[2-(trifluoromethylsulfinyl)acetyl]amino]phenyl]benzamide (PubChem CID 139571427) has the molecular formula C26H14Cl6F5N3O4S and a molecular weight of 772.19 g/mol. Its IUPAC name is 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[[2-(trifluoromethylsulfinyl)acetyl]amino]phenyl]benzamide.
| Compound Name | 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[[2-(trifluoromethylsulfinyl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 139571427 |
| Molecular Formula | C26H14Cl6F5N3O4S |
| Molecular Weight | 772.19 g/mol |
| Exact Mass | 768.88 |
| IUPAC Name | 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-[[2-(trifluoromethylsulfinyl)acetyl]amino]phenyl]benzamide |
| SMILES | O=C(CS(=O)C(F)(F)F)Nc1c(F)ccc(NC(=O)c2cc(NC(=O)C3[C@H](c4cc(Cl)c(Cl)c(Cl)c4)C3(Cl)Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C26H14Cl6F5N3O4S/c27-12-2-1-10(38-24(43)19-18(25(19,31)32)9-5-13(28)20(30)14(29)6-9)7-11(12)23(42)39-16-4-3-15(33)22(21(16)34)40-17(41)8-45(44)26(35,36)37/h1-7,18-19H,8H2,(H,38,43)(H,39,42)(H,40,41)/t18-,19?,45?/m0/s1 |
| InChIKey | GNQBOHSMIXYTTG-VUOFYQJESA-N |
| XLogP | 8.56 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.19 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|