C27H13Cl3F11N3O3 — CID 134418301
5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chloro-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide (PubChem CID 134418301) has the molecular formula C27H13Cl3F11N3O3 and a molecular weight of 742.76 g/mol. Its IUPAC name is 5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chloro-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide.
| Compound Name | 5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chloro-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 134418301 |
| Molecular Formula | C27H13Cl3F11N3O3 |
| Molecular Weight | 742.76 g/mol |
| Exact Mass | 740.98 |
| IUPAC Name | 5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2,2-dichlorocyclopropanecarbonyl]amino]-2-chloro-N-[2,4-difluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(F)c(NC(=O)C(F)(F)F)c1F)c1cc(NC(=O)C2C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C27H13Cl3F11N3O3/c28-14-2-1-12(8-13(14)21(45)43-16-4-3-15(31)20(19(16)32)44-23(47)27(39,40)41)42-22(46)18-17(24(18,29)30)9-5-10(25(33,34)35)7-11(6-9)26(36,37)38/h1-8,17-18H,(H,42,46)(H,43,45)(H,44,47) |
| InChIKey | XRHUJAMRDYWLFC-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.76 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|