C27H12Cl6F9N3O3 — CID 134418956
2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]benzamide (PubChem CID 134418956) has the molecular formula C27H12Cl6F9N3O3 and a molecular weight of 810.11 g/mol. Its IUPAC name is 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]benzamide.
| Compound Name | 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 134418956 |
| Molecular Formula | C27H12Cl6F9N3O3 |
| Molecular Weight | 810.11 g/mol |
| Exact Mass | 806.89 |
| IUPAC Name | 2-chloro-5-[[(3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]-N-[2,4-difluoro-3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(F)c(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1F)c1cc(NC(=O)C2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C27H12Cl6F9N3O3/c28-11-2-1-9(43-22(47)17-16(24(17,32)33)8-5-12(29)18(31)13(30)6-8)7-10(11)21(46)44-15-4-3-14(34)20(19(15)35)45-23(48)25(36,37)26(38,39)27(40,41)42/h1-7,16-17H,(H,43,47)(H,44,46)(H,45,48)/t16-,17?/m0/s1 |
| InChIKey | BWEPENRBJPSOSC-BHWOMJMDSA-N |
| XLogP | 10.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.11 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|