C28H19Cl6F2N3O4 — CID 140860269
N-[3-[[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-2,6-difluorophenyl]oxolane-2-carboxamide (PubChem CID 140860269) has the molecular formula C28H19Cl6F2N3O4 and a molecular weight of 712.19 g/mol. Its IUPAC name is N-[3-[[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-2,6-difluorophenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-2,6-difluorophenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 140860269 |
| Molecular Formula | C28H19Cl6F2N3O4 |
| Molecular Weight | 712.19 g/mol |
| Exact Mass | 708.95 |
| IUPAC Name | N-[3-[[2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(3,4,5-trichlorophenyl)cyclopropanecarbonyl]amino]benzoyl]amino]-2,6-difluorophenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(NC(=O)C2CCCO2)c1F)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)c(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C28H19Cl6F2N3O4/c29-14-4-3-12(37-27(42)21-20(28(21,33)34)11-8-15(30)22(32)16(31)9-11)10-13(14)25(40)38-18-6-5-17(35)24(23(18)36)39-26(41)19-2-1-7-43-19/h3-6,8-10,19-21H,1-2,7H2,(H,37,42)(H,38,40)(H,39,41)/t19?,20-,21+/m0/s1 |
| InChIKey | IYGURHKBKVEVBH-GJGLBJJNSA-N |
| XLogP | 8.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.19 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|