C17H10Cl3F2IN2O2 — CID 166988687
2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-(2,4-difluoro-3-iodophenyl)benzamide (PubChem CID 166988687) has the molecular formula C17H10Cl3F2IN2O2 and a molecular weight of 545.54 g/mol. Its IUPAC name is 2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-(2,4-difluoro-3-iodophenyl)benzamide.
| Compound Name | 2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-(2,4-difluoro-3-iodophenyl)benzamide |
|---|---|
| PubChem CID | 166988687 |
| Molecular Formula | C17H10Cl3F2IN2O2 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 543.88 |
| IUPAC Name | 2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]-N-(2,4-difluoro-3-iodophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(I)c1F)c1cc(NC(=O)C2CC2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C17H10Cl3F2IN2O2/c18-10-2-1-7(24-16(27)9-6-17(9,19)20)5-8(10)15(26)25-12-4-3-11(21)14(23)13(12)22/h1-5,9H,6H2,(H,24,27)(H,25,26) |
| InChIKey | JMSPFHZINQVBAL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|