C17H13Cl3FN3O2 — CID 166992601
N-(2-amino-3-fluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide (PubChem CID 166992601) has the molecular formula C17H13Cl3FN3O2 and a molecular weight of 416.67 g/mol. Its IUPAC name is N-(2-amino-3-fluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide.
| Compound Name | N-(2-amino-3-fluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 166992601 |
| Molecular Formula | C17H13Cl3FN3O2 |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | N-(2-amino-3-fluorophenyl)-2-chloro-5-[(2,2-dichlorocyclopropanecarbonyl)amino]benzamide |
| SMILES | Nc1c(F)cccc1NC(=O)c1cc(NC(=O)C2CC2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C17H13Cl3FN3O2/c18-11-5-4-8(23-16(26)10-7-17(10,19)20)6-9(11)15(25)24-13-3-1-2-12(21)14(13)22/h1-6,10H,7,22H2,(H,23,26)(H,24,25) |
| InChIKey | VOCANWIYYCFLEA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|