C17H11Cl3F3N3O2 — CID 166988621
N-(3-amino-2,4-difluorophenyl)-6-chloro-3-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorobenzamide (PubChem CID 166988621) has the molecular formula C17H11Cl3F3N3O2 and a molecular weight of 452.65 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-6-chloro-3-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorobenzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-6-chloro-3-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 166988621 |
| Molecular Formula | C17H11Cl3F3N3O2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-6-chloro-3-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorobenzamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2c(Cl)ccc(NC(=O)C3CC3(Cl)Cl)c2F)c1F |
| InChI | InChI=1S/C17H11Cl3F3N3O2/c18-7-1-3-9(25-15(27)6-5-17(6,19)20)12(22)11(7)16(28)26-10-4-2-8(21)14(24)13(10)23/h1-4,6H,5,24H2,(H,25,27)(H,26,28) |
| InChIKey | JTBANELCOJNKFL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|