C24H13Cl4F6N3O2 — CID 138703038
N-(3-amino-2,4-difluorophenyl)-2,6-dichloro-3-[[2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide (PubChem CID 138703038) has the molecular formula C24H13Cl4F6N3O2 and a molecular weight of 631.19 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-2,6-dichloro-3-[[2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-2,6-dichloro-3-[[2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 138703038 |
| Molecular Formula | C24H13Cl4F6N3O2 |
| Molecular Weight | 631.19 g/mol |
| Exact Mass | 628.97 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-2,6-dichloro-3-[[2,2-dichloro-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1c(F)ccc(NC(=O)c2c(Cl)ccc(NC(=O)C3C(c4ccc(F)c(C(F)(F)F)c4)C3(Cl)Cl)c2Cl)c1F |
| InChI | InChI=1S/C24H13Cl4F6N3O2/c25-10-2-5-13(18(26)15(10)21(38)37-14-6-4-12(30)20(35)19(14)31)36-22(39)17-16(23(17,27)28)8-1-3-11(29)9(7-8)24(32,33)34/h1-7,16-17H,35H2,(H,36,39)(H,37,38) |
| InChIKey | WCOVLPWWVBHOOU-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.19 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|