C19H14Cl5FN2O2 — CID 134418257
2,6-dichloro-3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide (PubChem CID 134418257) has the molecular formula C19H14Cl5FN2O2 and a molecular weight of 498.60 g/mol. Its IUPAC name is 2,6-dichloro-3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide.
| Compound Name | 2,6-dichloro-3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 134418257 |
| Molecular Formula | C19H14Cl5FN2O2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 495.95 |
| IUPAC Name | 2,6-dichloro-3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1c(Cl)ccc(NC(=O)C2C(c3ccc(F)c(Cl)c3)C2(Cl)Cl)c1Cl |
| InChI | InChI=1S/C19H14Cl5FN2O2/c1-2-26-17(28)13-9(20)4-6-12(16(13)22)27-18(29)15-14(19(15,23)24)8-3-5-11(25)10(21)7-8/h3-7,14-15H,2H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | CICJZTKUBVOSRA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|