C19H13Cl3F4N2O2 — CID 134418337
3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-2,6-difluoro-N-(2-fluoroethyl)benzamide (PubChem CID 134418337) has the molecular formula C19H13Cl3F4N2O2 and a molecular weight of 483.68 g/mol. Its IUPAC name is 3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-2,6-difluoro-N-(2-fluoroethyl)benzamide.
| Compound Name | 3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-2,6-difluoro-N-(2-fluoroethyl)benzamide |
|---|---|
| PubChem CID | 134418337 |
| Molecular Formula | C19H13Cl3F4N2O2 |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 3-[[2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]-2,6-difluoro-N-(2-fluoroethyl)benzamide |
| SMILES | O=C(NCCF)c1c(F)ccc(NC(=O)C2C(c3ccc(F)c(Cl)c3)C2(Cl)Cl)c1F |
| InChI | InChI=1S/C19H13Cl3F4N2O2/c20-9-7-8(1-2-10(9)24)14-15(19(14,21)22)18(30)28-12-4-3-11(25)13(16(12)26)17(29)27-6-5-23/h1-4,7,14-15H,5-6H2,(H,27,29)(H,28,30) |
| InChIKey | UWGXZOJFNOLPJD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|