C20H15Cl6FN2O2 — CID 140860308
2,6-dichloro-N-(3-chloropropyl)-3-[[(1R,3R)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 140860308) has the molecular formula C20H15Cl6FN2O2 and a molecular weight of 547.07 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-chloropropyl)-3-[[(1R,3R)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2,6-dichloro-N-(3-chloropropyl)-3-[[(1R,3R)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 140860308 |
| Molecular Formula | C20H15Cl6FN2O2 |
| Molecular Weight | 547.07 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | 2,6-dichloro-N-(3-chloropropyl)-3-[[(1R,3R)-2,2-dichloro-3-(3-chloro-4-fluorophenyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | O=C(NCCCCl)c1c(Cl)ccc(NC(=O)[C@H]2[C@H](c3ccc(F)c(Cl)c3)C2(Cl)Cl)c1Cl |
| InChI | InChI=1S/C20H15Cl6FN2O2/c21-6-1-7-28-18(30)14-10(22)3-5-13(17(14)24)29-19(31)16-15(20(16,25)26)9-2-4-12(27)11(23)8-9/h2-5,8,15-16H,1,6-7H2,(H,28,30)(H,29,31)/t15-,16+/m0/s1 |
| InChIKey | UMXSCAFSVWLKNS-JKSUJKDBSA-N |
| XLogP | 6.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.07 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|